374537-99-2 7-Amino-5-bromoindole
product Name |
7-Amino-5-bromoindole |
CAS No |
374537-99-2 |
Synonyms |
5-Bromo-7-indolamine; 5-bromo-1H-indol-7-amine |
Molecular Formula |
C8H7BrN2 |
Molecular Weight |
211.0586 |
InChI |
InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
Molecular Structure |
|
Density |
1.753g/cm3 |
Boiling point |
405.6°C at 760 mmHg |
Refractive index |
1.779 |
Flash point |
199.1°C |
Vapour Pressur |
8.68E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|