ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
| product Name |
4-Fluoro-3-formylbenzeneboronic acid |
| CAS No |
374538-01-9 |
| Synonyms |
5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
| Molecular Formula |
C7H6BFO3 |
| Molecular Weight |
167.9301 |
| InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Boiling point |
342.9°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
161.2°C |
| Vapour Pressur |
2.8E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
