ChemNet > CAS > 374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
| product Name |
4-Bromo-3-fluorobenzeneboronic acid |
| CAS No |
374790-97-3 |
| Synonyms |
4-Bromo-3-fluorophenylboronic acid |
| Molecular Formula |
C6H5BBrFO2 |
| Molecular Weight |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| Molecular Structure |
|
| Density |
1.75g/cm3 |
| Boiling point |
314.7°C at 760 mmHg |
| Refractive index |
1.571 |
| Flash point |
144.1°C |
| Vapour Pressur |
0.000195mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
