37526-88-8 Benzyl tiglate
product Name |
Benzyl tiglate |
CAS No |
37526-88-8 |
Synonyms |
Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate |
Molecular Formula |
C12H14O2 |
Molecular Weight |
190.2384 |
InChI |
InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
EINECS |
253-544-8 |
Molecular Structure |
|
Density |
1.027g/cm3 |
Boiling point |
267.7°C at 760 mmHg |
Refractive index |
1.516 |
Flash point |
135.9°C |
Vapour Pressur |
0.00802mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|