ChemNet > CAS > 37529-30-9 4-decylaniline
37529-30-9 4-decylaniline
| product Name |
4-decylaniline |
| CAS No |
37529-30-9 |
| Synonyms |
4-n-Decylaniline |
| Molecular Formula |
C16H27N |
| Molecular Weight |
233.3923 |
| InChI |
InChI=1/C16H27N/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h11-14H,2-10,17H2,1H3 |
| EINECS |
253-546-9 |
| Molecular Structure |
|
| Density |
0.909g/cm3 |
| Melting point |
25℃ |
| Boiling point |
364.4°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
150°C |
| Vapour Pressur |
1.69E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
