ChemNet > CAS > 37593-06-9 1-(4-decylphenyl)ethan-1-one
37593-06-9 1-(4-decylphenyl)ethan-1-one
| product Name |
1-(4-decylphenyl)ethan-1-one |
| CAS No |
37593-06-9 |
| Synonyms |
1-(4-decylphenyl)ethanone |
| Molecular Formula |
C18H28O |
| Molecular Weight |
260.4143 |
| InChI |
InChI=1/C18H28O/c1-3-4-5-6-7-8-9-10-11-17-12-14-18(15-13-17)16(2)19/h12-15H,3-11H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.911g/cm3 |
| Melting point |
33℃ |
| Boiling point |
371.4°C at 760 mmHg |
| Refractive index |
1.491 |
| Flash point |
156.6°C |
| Vapour Pressur |
1.04E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
