| product Name |
melamine cyanurate |
| CAS No |
37640-57-6 |
| Synonyms |
Melamine cyanurate(1:1); Non-halogen flame-retardant MPP; 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compd. with 1,3,5-triazine-2,4,6-triamine (1:1); 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, compound with 1,3,5-triazine-2,4,6-triamine (1:1); s-Triazine, 2,4,6-triamino-, compd. with s-triazine-triol; Melamine isocyanurate; Melamine-cyanuric acid compd; Melaminkyanurat; Melamine Cyanurate(MCA) |
| Molecular Formula |
C6H9N9O3 |
| Molecular Weight |
255.20 |
| InChI |
InChI=1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9) |
| EINECS |
253-575-7 |
| Molecular Structure |
|
| Density |
1.70g/cm3 |
| Melting point |
350℃ (dec.) |
| Boiling point |
388.7°C at 760 mmHg |
| Refractive index |
1.571 |
| Flash point |
188.9°C |
| Water solubility |
insoluble |
| Vapour Pressur |
1.2E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
