ChemNet > CAS > 3766-55-0 4-Allylthiosemicarbazide
3766-55-0 4-Allylthiosemicarbazide
| product Name |
4-Allylthiosemicarbazide |
| Synonyms |
4-Allyl-3-thiosemicarbazide; N-(prop-2-en-1-yl)hydrazinecarbothioamide |
| Molecular Formula |
C4H9N3S |
| Molecular Weight |
131.1994 |
| InChI |
InChI=1/C4H9N3S/c1-2-3-6-4(8)7-5/h2H,1,3,5H2,(H2,6,7,8) |
| CAS Registry Number |
3766-55-0 |
| EINECS |
223-186-7 |
| Molecular Structure |
|
| Density |
1.131g/cm3 |
| Melting point |
93-96℃ |
| Boiling point |
209.8°C at 760 mmHg |
| Refractive index |
1.575 |
| Flash point |
80.7°C |
| Vapour Pressur |
0.199mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
4-Allylthiosemicarbazide Material Safety Data Sheet
|
|
