ChemNet > CAS > 3770-82-9 1,3-Dibenzoylbenzene
3770-82-9 1,3-Dibenzoylbenzene
| product Name |
1,3-Dibenzoylbenzene |
| CAS No |
3770-82-9 |
| Synonyms |
3-Benzoylbenzophenone; benzene-1,3-diylbis(phenylmethanone) |
| Molecular Formula |
C20H14O2 |
| Molecular Weight |
286.324 |
| InChI |
InChI=1/C20H14O2/c21-19(15-8-3-1-4-9-15)17-12-7-13-18(14-17)20(22)16-10-5-2-6-11-16/h1-14H |
| EINECS |
223-210-6 |
| Molecular Structure |
|
| Density |
1.165g/cm3 |
| Melting point |
98-108℃ |
| Boiling point |
467.5°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
173.8°C |
| Vapour Pressur |
6.49E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
