ChemNet > CAS > 3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
| product Name |
Diethyl 1,1-cyclobutanedicarboxylate |
| CAS No |
3779-29-1 |
| Synonyms |
1,1-Cyclobutanedicarboxylic acid diethyl ester; diethyl cyclobutane-1,1-dicarboxylate; Diethyl-1,1-cyclobutane dicarboxylate |
| Molecular Formula |
C10H16O4 |
| Molecular Weight |
200.2316 |
| InChI |
InChI=1/C10H16O4/c1-3-13-8(11)10(6-5-7-10)9(12)14-4-2/h3-7H2,1-2H3 |
| EINECS |
223-239-4 |
| Molecular Structure |
|
| Density |
1.127g/cm3 |
| Boiling point |
224.5°C at 760 mmHg |
| Refractive index |
1.469 |
| Flash point |
99.7°C |
| Vapour Pressur |
0.0907mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Cao xiaoming |
| Telephone |
0575-82735651 |
| Email |
cxm@zbpharm.com |
| Address |
No.3 WeiWu Road, Hangzhou Bay Shangyu Economic and Techological Development Area, Zhejiang Province,312369 P.R.China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Telephone |
+86-21-61066956/57/58£¬61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
MR.Yan |
| Telephone |
+8657187837895 |
| Email |
shaoping.yan@karrypharma.com |
| Address |
Room 409, Building D, No.1378 West Wenyi Road, Yuhang District, Hangzhou, 311121, Zhejiang, China |