| product Name |
cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |
| Synonyms |
r-1,c-2,c-3,c-4-Cyclopentanetetracarboxylic acid; AI3-50868; 1,2,3,4-Cyclopentanetetracarboxylic acid, (1alpha,2alpha,3alpha,4alpha)-; (1R,2R,3S,4S)-cyclopentane-1,2,3,4-tetracarboxylic acid; (1R,2R,3R,4S)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3S,4S)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3S,4R)-cyclopentane-1,2,3,4-tetracarboxylate; (2R,3S,4R,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name) |
| Molecular Formula |
C8H4O9 |
| Molecular Weight |
244.1142 |
| InChI |
InChI=1/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/p-4/t1-,2+,3+,4- |
| CAS Registry Number |
3786-91-2 |
| EINECS |
223-256-7 |
| Molecular Structure |
|
| Melting point |
192-195℃ |
| Boiling point |
597.011°C at 760 mmHg |
| Flash point |
243.903°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid Material Safety Data Sheet
|
|
