ChemNet > CAS > 38002-89-0 (2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)methanol
38002-89-0 (2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)methanol
| product Name |
(2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)methanol |
| CAS No |
38002-89-0 |
| Molecular Formula |
C11H14O2 |
| Molecular Weight |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-11(2)6-8-4-3-5-9(7-12)10(8)13-11/h3-5,12H,6-7H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.101g/cm3 |
| Melting point |
55.7℃ |
| Boiling point |
293.6°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
127.8°C |
| Vapour Pressur |
0.000778mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
