ChemNet > CAS > 3815-20-1 4-Biphenylcarboxamide
3815-20-1 4-Biphenylcarboxamide
| product Name |
4-Biphenylcarboxamide |
| CAS No |
3815-20-1 |
| Synonyms |
4-Phenylbenzamide; biphenyl-4-carboxamide |
| Molecular Formula |
C13H11NO |
| Molecular Weight |
197.2325 |
| InChI |
InChI=1/C13H11NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,14,15) |
| Molecular Structure |
|
| Density |
1.137g/cm3 |
| Boiling point |
381.4°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
184.5°C |
| Vapour Pressur |
5.09E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
