ChemNet > CAS > 3815-86-9 Propanedioyl dihydrazide
3815-86-9 Propanedioyl dihydrazide
| product Name |
Propanedioyl dihydrazide |
| CAS No |
3815-86-9 |
| Synonyms |
Malonic dihydrazide; Malconic acid dihydrazide; propanedihydrazide |
| Molecular Formula |
C3H8N4O2 |
| Molecular Weight |
132.1212 |
| InChI |
InChI=1/C3H8N4O2/c4-6-2(8)1-3(9)7-5/h1,4-5H2,(H,6,8)(H,7,9) |
| Molecular Structure |
|
| Density |
1.358g/cm3 |
| Boiling point |
554°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
288.8°C |
| Vapour Pressur |
2.59E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
