38291-82-6 Valeric acid hydrazide
product Name |
Valeric acid hydrazide |
CAS No |
38291-82-6 |
Synonyms |
Pentanoic acid hydrazide; pentanehydrazide |
Molecular Formula |
C5H12N2O |
Molecular Weight |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
EINECS |
253-864-8 |
Molecular Structure |
|
Density |
0.962g/cm3 |
Boiling point |
260.6°C at 760 mmHg |
Refractive index |
1.449 |
Flash point |
111.4°C |
Vapour Pressur |
0.0122mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|