ChemNet > CAS > 384-67-8 Chlorodifluoroacetophenone
384-67-8 Chlorodifluoroacetophenone
| product Name |
Chlorodifluoroacetophenone |
| CAS No |
384-67-8 |
| Synonyms |
2-Chloro-2,2-difluoro-1-phenylethanone; 2-Chloro-2,2-difluoroacetophenone; alpha-Chloro-alpha,alpha-difluoroacetophene; ethanone, 2-chloro-2,2-difluoro-1-phenyl-; GXFFVR; N-(2-fluorophenyl)-β-alanine; 2,2-Difluoro-2-chloroacetophenone; 2,2,2-Chlorodifluoroacetophenone |
| Molecular Formula |
C9H10FNO2 |
| Molecular Weight |
183.1796 |
| InChI |
InChI=1/C9H10FNO2/c10-7-3-1-2-4-8(7)11-6-5-9(12)13/h1-4,11H,5-6H2,(H,12,13) |
| Molecular Structure |
|
| Density |
1.301g/cm3 |
| Boiling point |
357.2°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
169.8°C |
| Vapour Pressur |
1.01E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
