CAS No: 38411-22-2;153084-05-0, Chemical Name: 2,2',3,3',6,6'-hexachlorobiphenyl
the physical and chemical property of 38411-22-2;153084-05-0, 2,2',3,3',6,6'-hexachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 38411-22-2;153084-05-0 2,2',3,3',6,6'-hexachlorobiphenyl
38411-22-2;153084-05-0 2,2',3,3',6,6'-hexachlorobiphenyl
| product Name |
2,2',3,3',6,6'-hexachlorobiphenyl |
| Synonyms |
1,1'-biphenyl, 2,2',3,3',6,6'-hexachloro-; 2,2',3,3',6,6'-Hexachlorobiphenyl; 2,2',3,3',6,6'-PCB; 38411-22-2 |
| Molecular Formula |
C12H4Cl6 |
| Molecular Weight |
360.8782 |
| InChI |
InChI=1/C12H4Cl6/c13-5-1-3-7(15)11(17)9(5)10-6(14)2-4-8(16)12(10)18/h1-4H |
| CAS Registry Number |
38411-22-2;153084-05-0 |
| Molecular Structure |
|
| Density |
1.593g/cm3 |
| Boiling point |
371.2°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
174.7°C |
| Vapour Pressur |
2.24E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
