38460-95-6 10-Undecenoyl chloride
product Name |
10-Undecenoyl chloride |
CAS No |
38460-95-6 |
Synonyms |
Undecenoylchloride; ; 10-Undeconyl chloride |
Molecular Formula |
C11H19ClO |
Molecular Weight |
202.72 |
InChI |
InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2 |
EINECS |
253-951-0 |
Molecular Structure |
|
Density |
0.94 |
Boiling point |
120-122℃ (10 torr) |
Refractive index |
1.4532-1.4552 |
Flash point |
93℃ |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
MSDS |
Material Safety Data Sheet
|
|