ChemNet > CAS > 38460-95-6 10-Undecenoyl chloride
38460-95-6 10-Undecenoyl chloride
| product Name |
10-Undecenoyl chloride |
| CAS No |
38460-95-6 |
| Synonyms |
Undecenoylchloride; ; 10-Undeconyl chloride |
| Molecular Formula |
C11H19ClO |
| Molecular Weight |
202.72 |
| InChI |
InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2 |
| EINECS |
253-951-0 |
| Molecular Structure |
|
| Density |
0.94 |
| Boiling point |
120-122℃ (10 torr) |
| Refractive index |
1.4532-1.4552 |
| Flash point |
93℃ |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
| MSDS |
Material Safety Data Sheet
|
|
