ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
| product Name |
5-Methyl-2-furanmethanol |
| CAS No |
3857-25-8 |
| Synonyms |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
| Molecular Formula |
C6H8O2 |
| Molecular Weight |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
| Molecular Structure |
|
| Density |
1.095g/cm3 |
| Boiling point |
178.5°C at 760 mmHg |
| Refractive index |
1.494 |
| Flash point |
61.8°C |
| Vapour Pressur |
0.647mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
