ChemNet > CAS > 3893-23-0 Cyclohexylphenylacetonitrile
3893-23-0 Cyclohexylphenylacetonitrile
| product Name |
Cyclohexylphenylacetonitrile |
| CAS No |
3893-23-0 |
| Synonyms |
alpha-Phenylcyclohexaneacetonitrile; alpha-Cyclohexylphenylacetonitrile; (2S)-cyclohexyl(phenyl)ethanenitrile; (2R)-cyclohexyl(phenyl)ethanenitrile |
| Molecular Formula |
C14H17N |
| Molecular Weight |
199.2915 |
| InChI |
InChI=1/C14H17N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-10H2/t14-/m0/s1 |
| EINECS |
223-442-8 |
| Molecular Structure |
|
| Density |
1.019g/cm3 |
| Melting point |
49-55℃ |
| Boiling point |
322.5°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
156.3°C |
| Vapour Pressur |
0.000279mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
