ChemNet > CAS > 3894-09-5 Cyclohexylphenylacetic acid
3894-09-5 Cyclohexylphenylacetic acid
| product Name |
Cyclohexylphenylacetic acid |
| Synonyms |
alpha-Phenylcyclohexaneacetic acid; (2R)-cyclohexyl(phenyl)ethanoate; (2S)-cyclohexyl(phenyl)ethanoate |
| Molecular Formula |
C14H17O2 |
| Molecular Weight |
217.2841 |
| InChI |
InChI=1/C14H18O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2,(H,15,16)/p-1/t13-/m1/s1 |
| CAS Registry Number |
3894-09-5 |
| EINECS |
223-443-3 |
| Molecular Structure |
|
| Melting point |
148-151℃ |
| Boiling point |
353.3°C at 760 mmHg |
| Flash point |
250.2°C |
| Vapour Pressur |
1.34E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Cyclohexylphenylacetic acid Material Safety Data Sheet
|
|
