ChemNet > CAS > 38940-62-4 Ethanone, 1-(5-bromo-3-pyridinyl)-
38940-62-4 Ethanone, 1-(5-bromo-3-pyridinyl)-
| product Name |
Ethanone, 1-(5-bromo-3-pyridinyl)- |
| CAS No |
38940-62-4 |
| Synonyms |
3-Acetyl-5-bromopyridine; 1-(5-bromopyridin-3-yl)ethanone |
| Molecular Formula |
C7H6BrNO |
| Molecular Weight |
200.0326 |
| InChI |
InChI=1/C7H6BrNO/c1-5(10)6-2-7(8)4-9-3-6/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.534g/cm3 |
| Boiling point |
279.321°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
122.729°C |
| Vapour Pressur |
0.004mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
