ChemNet > CAS > 3916-18-5 DL-DOPS
3916-18-5 DL-DOPS
| product Name |
DL-DOPS |
| CAS No |
3916-18-5 |
| Synonyms |
DL-threo-3,4-Dihydroxyphenylserine; D,L-dops F&D version of D-2384; H-DL-.beta.-(3,4-Dihydroxyphenyl)-DL-Ser-OH; (betaR)-beta,3-dihydroxy-L-tyrosine; (2R,3R)-2-ammonio-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoate; (2Rs,3Rs)-2-Amino-3-(3,4-Dihydroxy-Phenyl)-3-Hydroxy-Propionic Acid |
| Molecular Formula |
C9H11NO5 |
| Molecular Weight |
213.1873 |
| InChI |
InChI=1/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8-/m1/s1 |
| EINECS |
223-480-5 |
| Molecular Structure |
|
| Density |
1.608g/cm3 |
| Melting point |
200℃ |
| Boiling point |
549.8°C at 760 mmHg |
| Refractive index |
1.692 |
| Flash point |
286.3°C |
| Vapour Pressur |
6.39E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
