ChemNet > CAS > 39244-10-5 3-(3-Furyl)acrylic acid
39244-10-5 3-(3-Furyl)acrylic acid
| product Name |
3-(3-Furyl)acrylic acid |
| CAS No |
39244-10-5 |
| Synonyms |
Furan-3-acrylic acid; (2E)-3-(furan-3-yl)prop-2-enoic acid; 3-Furanacrylic acid; 3-Furanylacrylic acid |
| Molecular Formula |
C7H6O3 |
| Molecular Weight |
138.1207 |
| InChI |
InChI=1/C7H6O3/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1+ |
| Molecular Structure |
|
| Density |
1.28g/cm3 |
| Boiling point |
261.4°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
111.9°C |
| Vapour Pressur |
0.00587mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
