394-35-4 methyl 2-fluorobenzoate
| product Name |
methyl 2-fluorobenzoate |
| CAS No |
394-35-4 |
| Synonyms |
2-Fluorobenzoic acid methyl ester |
| Molecular Formula |
C8H7FO2 |
| Molecular Weight |
154.14 |
| InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| EINECS |
206-894-0 |
| Molecular Structure |
|
| Density |
1.21 |
| Boiling point |
99℃ (18 torr) |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Andy Yang |
| Telephone |
+86-21-50933265 |
| Email |
andy@wesscco.com |
| Address |
No.87,Lane 1296,Jingao Road,Pudong New District,Shanghai-201206 |