ChemNet > CAS > 3945-18-4 3,4-Di-O-acetyl-L-arabinal
3945-18-4 3,4-Di-O-acetyl-L-arabinal
| product Name |
3,4-Di-O-acetyl-L-arabinal |
| CAS No |
3945-18-4 |
| Synonyms |
2,3-di-O-acetyl-1,5-anhydro-4-deoxy-D-erythro-pent-4-enitol |
| Molecular Formula |
C9H12O5 |
| Molecular Weight |
200.1886 |
| InChI |
InChI=1/C9H12O5/c1-6(10)13-8-3-4-12-5-9(8)14-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9+/m1/s1 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Boiling point |
266.2°C at 760 mmHg |
| Refractive index |
1.476 |
| Flash point |
112.8°C |
| Vapour Pressur |
0.00878mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
