ChemNet > CAS > 3949-36-8 3-Acetylcoumarin
3949-36-8 3-Acetylcoumarin
| product Name |
3-Acetylcoumarin |
| CAS No |
3949-36-8 |
| Synonyms |
3-acetyl-2H-chromen-2-one
; 3-acetyl-2H-chromen-2-one |
| Molecular Formula |
C11H8O3 |
| Molecular Weight |
188.1794 |
| InChI |
InChI=1/C11H8O3/c1-7(12)9-6-8-4-2-3-5-10(8)14-11(9)13/h2-6H,1H3 |
| EINECS |
223-541-6 |
| Molecular Structure |
|
| Density |
1.285g/cm3 |
| Melting point |
120-125℃ |
| Boiling point |
391.6°C at 760 mmHg |
| Refractive index |
1.583 |
| Flash point |
179°C |
| Vapour Pressur |
2.43E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
