ChemNet > CAS > 3956-63-6 2,4-Dichlorophenoxyacetonitrile
3956-63-6 2,4-Dichlorophenoxyacetonitrile
| product Name |
2,4-Dichlorophenoxyacetonitrile |
| CAS No |
3956-63-6 |
| Molecular Formula |
C8H5Cl2NO |
| Molecular Weight |
202.0374 |
| InChI |
InChI=1/C8H5Cl2NO/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2 |
| Molecular Structure |
|
| Density |
1.372g/cm3 |
| Melting point |
46℃ |
| Boiling point |
311.8°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
142.4°C |
| Vapour Pressur |
0.000549mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
