ChemNet > CAS > 39593-08-3 Methylphenylpiperazine
39593-08-3 Methylphenylpiperazine
| product Name |
Methylphenylpiperazine |
| CAS No |
39593-08-3 |
| Synonyms |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
| Molecular Formula |
C11H16N2 |
| Molecular Weight |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| EINECS |
254-534-6 |
| Molecular Structure |
|
| Density |
1.012g/cm3 |
| Boiling point |
321.2°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
153.8°C |
| Vapour Pressur |
0.000303mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
