ChemNet > CAS > 396-64-5 3,3'-difluorobiphenyl
396-64-5 3,3'-difluorobiphenyl
| product Name |
3,3'-difluorobiphenyl |
| CAS No |
396-64-5 |
| Synonyms |
3,3-Difluorodiphenyl |
| Molecular Formula |
C12H8F2 |
| Molecular Weight |
190.1887 |
| InChI |
InChI=1/C12H8F2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H |
| EINECS |
206-905-9 |
| Molecular Structure |
|
| Density |
1.165g/cm3 |
| Melting point |
6℃ |
| Boiling point |
262.2°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
92.7°C |
| Vapour Pressur |
0.018mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
