ChemNet > CAS > 39635-11-5 3,4-Dihydroxybenzhydrazide
39635-11-5 3,4-Dihydroxybenzhydrazide
| product Name |
3,4-Dihydroxybenzhydrazide |
| CAS No |
39635-11-5 |
| Synonyms |
3,4-Dihyroxybenzhydraide; 3,4-dihydroxybenzohydrazide |
| Molecular Formula |
C7H8N2O3 |
| Molecular Weight |
168.15 |
| InChI |
InChI=1/C7H8N2O3/c8-9-7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H,8H2,(H,9,12) |
| EINECS |
254-550-3 |
| Molecular Structure |
|
| Density |
1.477g/cm3 |
| Refractive index |
1.67 |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
