ChemNet > CAS > 3964-58-7 3-Chloro-4-hydroxybenzoic acid hemihydrate
3964-58-7 3-Chloro-4-hydroxybenzoic acid hemihydrate
| product Name |
3-Chloro-4-hydroxybenzoic acid hemihydrate |
| CAS No |
3964-58-7 |
| Synonyms |
3-Chloro-4-hydroxybenzoic acid; 3-chloro-4-hydroxybenzoic acid hydrate; 3-chloro-4-hydroxybenzoate |
| Molecular Formula |
C7H4ClO3 |
| Molecular Weight |
171.5584 |
| InChI |
InChI=1/C7H5ClO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,(H,10,11)/p-1 |
| EINECS |
223-574-6 |
| Molecular Structure |
|
| Melting point |
168-172℃ |
| Boiling point |
330.5°C at 760 mmHg |
| Flash point |
153.7°C |
| Vapour Pressur |
6.65E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
