ChemNet > CAS > 39769-09-0 4,4'-Difluorobenzylideneaniline
39769-09-0 4,4'-Difluorobenzylideneaniline
| product Name |
4,4'-Difluorobenzylideneaniline |
| CAS No |
39769-09-0 |
| Synonyms |
4-fluoro-N-[(1E)-(4-fluorophenyl)methylidene]aniline |
| Molecular Formula |
C13H9F2N |
| Molecular Weight |
217.2141 |
| InChI |
InChI=1/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Melting point |
64℃ |
| Boiling point |
307.4°C at 760 mmHg |
| Refractive index |
1.527 |
| Flash point |
139.7°C |
| Vapour Pressur |
0.00132mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
