ChemNet > CAS > 3988-03-2 4,4'-dibromobenzophenone
3988-03-2 4,4'-dibromobenzophenone
| product Name |
4,4'-dibromobenzophenone |
| CAS No |
3988-03-2 |
| Synonyms |
Bis(p-bromophenyl) ketone; NSC 86518; p,p'-Dibromobenzophenone; Benzophenone, 4,4'-dibromo- (8CI); Methanone, bis(4-bromophenyl)- (9CI); bis(4-bromophenyl)methanone |
| Molecular Formula |
C13H8Br2O |
| Molecular Weight |
340.01 |
| InChI |
InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| EINECS |
223-632-0 |
| Molecular Structure |
|
| Density |
1.7g/cm3 |
| Melting point |
171-174℃ |
| Boiling point |
395.6°C at 760 mmHg |
| Refractive index |
1.633 |
| Flash point |
121°C |
| Vapour Pressur |
1.82E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
|
