ChemNet > CAS > 3989-36-4 Ethyl 1,2,3-thiadiazole-4-carboxylate
3989-36-4 Ethyl 1,2,3-thiadiazole-4-carboxylate
| product Name |
Ethyl 1,2,3-thiadiazole-4-carboxylate |
| CAS No |
3989-36-4 |
| Molecular Formula |
C5H6N2O2S |
| Molecular Weight |
158.1783 |
| InChI |
InChI=1/C5H6N2O2S/c1-2-9-5(8)4-3-10-7-6-4/h3H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Melting point |
83-84℃ |
| Boiling point |
231.1°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
93.6°C |
| Vapour Pressur |
0.0633mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
