ChemNet > CAS > 39891-12-8 5-Bromo-3-pyridylacetic acid
39891-12-8 5-Bromo-3-pyridylacetic acid
| product Name |
5-Bromo-3-pyridylacetic acid |
| CAS No |
39891-12-8 |
| Synonyms |
5-Bromo-3-pyridineacetic acid; (5-bromopyridin-3-yl)acetic acid |
| Molecular Formula |
C7H6BrNO2 |
| Molecular Weight |
216.032 |
| InChI |
InChI=1/C7H6BrNO2/c8-6-1-5(2-7(10)11)3-9-4-6/h1,3-4H,2H2,(H,10,11) |
| Molecular Structure |
|
| Density |
1.71g/cm3 |
| Boiling point |
349.9°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
165.4°C |
| Vapour Pressur |
1.7E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
