ChemNet > CAS > 39905-44-7 p-Heptyloxyaniline
39905-44-7 p-Heptyloxyaniline
| product Name |
p-Heptyloxyaniline |
| CAS No |
39905-44-7 |
| Synonyms |
4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
| Molecular Formula |
C13H21NO |
| Molecular Weight |
207.3119 |
| InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
| Molecular Structure |
|
| Density |
0.965g/cm3 |
| Boiling point |
325.9°C at 760 mmHg |
| Refractive index |
1.516 |
| Flash point |
145°C |
| Vapour Pressur |
0.000223mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
