ChemNet > CAS > 39969-56-7 1-bromo-4-propoxybenzene
39969-56-7 1-bromo-4-propoxybenzene
| product Name |
1-bromo-4-propoxybenzene |
| CAS No |
39969-56-7 |
| Synonyms |
4-n-Propoxybromobenzene |
| Molecular Formula |
C9H11BrO |
| Molecular Weight |
215.087 |
| InChI |
InChI=1/C9H11BrO/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6H,2,7H2,1H3 |
| Molecular Structure |
|
| Density |
1.322g/cm3 |
| Boiling point |
246°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
108.8°C |
| Vapour Pressur |
0.0436mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
