ChemNet > CAS > 39969-57-8 1-Bromo-4-butoxybenzene
39969-57-8 1-Bromo-4-butoxybenzene
| product Name |
1-Bromo-4-butoxybenzene |
| CAS No |
39969-57-8 |
| Synonyms |
p-Bromophenyl Butyl Ether; p-Butoxybromobenzene |
| Molecular Formula |
C10H13BrO |
| Molecular Weight |
229.1136 |
| InChI |
InChI=1/C10H13BrO/c1-2-3-8-12-10-6-4-9(11)5-7-10/h4-7H,2-3,8H2,1H3 |
| Molecular Structure |
|
| Density |
1.278g/cm3 |
| Boiling point |
263.9°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
114.7°C |
| Vapour Pressur |
0.0163mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
