ChemNet > CAS > 3999-55-1 Diethyl trans-1,2-cyclopropanedicarboxylate
3999-55-1 Diethyl trans-1,2-cyclopropanedicarboxylate
| product Name |
Diethyl trans-1,2-cyclopropanedicarboxylate |
| CAS No |
3999-55-1 |
| Synonyms |
diethyl (1R,2R)-cyclopropane-1,2-dicarboxylate |
| Molecular Formula |
C9H14O4 |
| Molecular Weight |
186.2051 |
| InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| Molecular Structure |
|
| Density |
1.153g/cm3 |
| Boiling point |
246.288°C at 760 mmHg |
| Refractive index |
1.469 |
| Flash point |
98.333°C |
| Vapour Pressur |
0.027mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
