ChemNet > CAS > 401-56-9 ethylchlorofluoroacetate
401-56-9 ethylchlorofluoroacetate
| product Name |
ethylchlorofluoroacetate |
| CAS No |
401-56-9 |
| Synonyms |
Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
| Molecular Formula |
C4H6ClFO2 |
| Molecular Weight |
140.5406 |
| InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| EINECS |
206-930-5 |
| Molecular Structure |
|
| Density |
1.219g/cm3 |
| Boiling point |
129°C at 760 mmHg |
| Refractive index |
1.39 |
| Flash point |
44.3°C |
| Vapour Pressur |
10.4mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
