ChemNet > CAS > 40101-17-5 m-Anisil
40101-17-5 m-Anisil
| product Name |
m-Anisil |
| CAS No |
40101-17-5 |
| Synonyms |
3,3-Dimethoxybenzil; 3,3-Dimethoxydibenzoyl; 1,2-bis(3-methoxyphenyl)ethane-1,2-dione |
| Molecular Formula |
C16H14O4 |
| Molecular Weight |
270.28 |
| InChI |
InChI=1/C16H14O4/c1-19-13-7-3-5-11(9-13)15(17)16(18)12-6-4-8-14(10-12)20-2/h3-10H,1-2H3 |
| EINECS |
254-793-5 |
| Molecular Structure |
|
| Density |
1.183g/cm3 |
| Boiling point |
442.2°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
197.5°C |
| Vapour Pressur |
5.13E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
