ChemNet > CAS > 4016-63-1 8-bromoguanosine
4016-63-1 8-bromoguanosine
| product Name |
8-bromoguanosine |
| CAS No |
4016-63-1 |
| Synonyms |
8-Bromoguanosine hydrate; 2-amino-8-bromo-9-pentofuranosyl-3,9-dihydro-6H-purin-6-one; 2-amino-8-bromo-9-beta-D-glycero-pentofuranosyl-5,9-dihydro-6H-purin-6-one; 8-Bromo-Guanosine; 8-Bromo Guanosine |
| Molecular Formula |
C10H12BrN5O5 |
| Molecular Weight |
362.1368 |
| InChI |
InChI=1/C10H12BrN5O5/c11-9-13-3-6(14-10(12)15-7(3)20)16(9)8-5(19)4(18)2(1-17)21-8/h2-5,8,17-19H,1H2,(H2,12,15,20)/t2-,3?,4?,5?,8-/m1/s1 |
| EINECS |
223-677-6 |
| Molecular Structure |
|
| Density |
2.62g/cm3 |
| Boiling point |
611.1°C at 760 mmHg |
| Refractive index |
1.986 |
| Flash point |
323.4°C |
| Vapour Pressur |
1.73E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
