ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
| product Name |
1-(3-fluorophenyl)ethanol |
| CAS No |
402-63-1 |
| Synonyms |
3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
| Molecular Formula |
C8H9FO |
| Molecular Weight |
140.1549 |
| InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| EINECS |
206-950-4 |
| Molecular Structure |
|
| Density |
1.123g/cm3 |
| Boiling point |
196.2°C at 760 mmHg |
| Refractive index |
1.51 |
| Flash point |
90.1°C |
| Vapour Pressur |
0.251mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
