ChemNet > CAS > 402832-08-0 3-O-Acetyl-4-fluoro-L-fucal
402832-08-0 3-O-Acetyl-4-fluoro-L-fucal
| product Name |
3-O-Acetyl-4-fluoro-L-fucal |
| CAS No |
402832-08-0 |
| Synonyms |
(5S)-3-O-acetyl-1,5-anhydro-2,4-dideoxy-4-fluoro-5-methyl-D-erythro-pent-1-enitol |
| Molecular Formula |
C8H11FO3 |
| Molecular Weight |
174.1695 |
| InChI |
InChI=1/C8H11FO3/c1-5-8(9)7(3-4-11-5)12-6(2)10/h3-5,7-8H,1-2H3/t5-,7-,8+/m0/s1 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Boiling point |
212.6°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
80.3°C |
| Vapour Pressur |
0.172mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
