ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| product Name |
2-Iodophenylacetonitrile |
| CAS No |
40400-15-5 |
| Synonyms |
2-Iodobenzyl cyanide |
| Molecular Formula |
C8H6IN |
| Molecular Weight |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| Molecular Structure |
|
| Density |
1.764g/cm3 |
| Boiling point |
306°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
138.8°C |
| Vapour Pressur |
0.000795mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
