ChemNet > CAS > 40784-88-1 Ethyl 4-ethoxyphenylacetate
40784-88-1 Ethyl 4-ethoxyphenylacetate
| product Name |
Ethyl 4-ethoxyphenylacetate |
| CAS No |
40784-88-1 |
| Synonyms |
4-Ethoxyphenylacetic acid ethyl ester |
| Molecular Formula |
C12H16O3 |
| Molecular Weight |
208.2536 |
| InChI |
InChI=1/C12H16O3/c1-3-14-11-7-5-10(6-8-11)9-12(13)15-4-2/h5-8H,3-4,9H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.045g/cm3 |
| Boiling point |
289.2°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
116.8°C |
| Vapour Pressur |
0.00224mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
