ChemNet > CAS > 40803-53-0 5-Bromo-2-methoxycinnamic acid
40803-53-0 5-Bromo-2-methoxycinnamic acid
| product Name |
5-Bromo-2-methoxycinnamic acid |
| CAS No |
40803-53-0 |
| Synonyms |
(2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoic acid; (2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| Molecular Formula |
C10H8BrO3 |
| Molecular Weight |
256.0733 |
| InChI |
InChI=1/C10H9BrO3/c1-14-9-4-3-8(11)6-7(9)2-5-10(12)13/h2-6H,1H3,(H,12,13)/p-1/b5-2+ |
| Molecular Structure |
|
| Melting point |
224-227℃ |
| Boiling point |
381.5°C at 760 mmHg |
| Flash point |
184.5°C |
| Vapour Pressur |
1.68E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
