ChemNet > CAS > 40877-09-6 4,4'-Dichlorobutyrophenone
40877-09-6 4,4'-Dichlorobutyrophenone
| product Name |
4,4'-Dichlorobutyrophenone |
| CAS No |
40877-09-6 |
| Synonyms |
4-Chloro-1-(4-chlorophenyl)-1-butanone; 4-chloro-1-(4-chlorophenyl)butan-1-one |
| Molecular Formula |
C10H10Cl2O |
| Molecular Weight |
217.0918 |
| InChI |
InChI=1/C10H10Cl2O/c11-7-1-2-10(13)8-3-5-9(12)6-4-8/h3-6H,1-2,7H2 |
| EINECS |
255-123-4 |
| Molecular Structure |
|
| Density |
1.224g/cm3 |
| Melting point |
29-30℃ |
| Boiling point |
333.8°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
140.7°C |
| Vapour Pressur |
0.000133mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
